C14H24N6O2 — CID 143113056
6-amino-2-butoxy-9-[4-(methylamino)butyl]-7H-purin-8-one (PubChem CID 143113056) has the molecular formula C14H24N6O2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-[4-(methylamino)butyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-butoxy-9-[4-(methylamino)butyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 143113056 |
| Molecular Formula | C14H24N6O2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 6-amino-2-butoxy-9-[4-(methylamino)butyl]-7H-purin-8-one |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCCNC)c2n1 |
| InChI | InChI=1S/C14H24N6O2/c1-3-4-9-22-13-18-11(15)10-12(19-13)20(14(21)17-10)8-6-5-7-16-2/h16H,3-9H2,1-2H3,(H,17,21)(H2,15,18,19) |
| InChIKey | IBPLNXPGDDDSCQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|