C25H37N7O4 — CID 68927873
2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-[3-(methylamino)propyl]amino]methyl]phenyl]acetic acid (PubChem CID 68927873) has the molecular formula C25H37N7O4 and a molecular weight of 499.62 g/mol. Its IUPAC name is 2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-[3-(methylamino)propyl]amino]methyl]phenyl]acetic acid.
| Compound Name | 2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-[3-(methylamino)propyl]amino]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 68927873 |
| Molecular Formula | C25H37N7O4 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | 2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-[3-(methylamino)propyl]amino]methyl]phenyl]acetic acid |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCN(CCCNC)Cc3cccc(CC(=O)O)c3)c2n1 |
| InChI | InChI=1S/C25H37N7O4/c1-3-4-14-36-24-29-22(26)21-23(30-24)32(25(35)28-21)13-7-12-31(11-6-10-27-2)17-19-9-5-8-18(15-19)16-20(33)34/h5,8-9,15,27H,3-4,6-7,10-14,16-17H2,1-2H3,(H,28,35)(H,33,34)(H2,26,29,30) |
| InChIKey | GSMRZDIUVXZOOI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 151.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|