C32H41N7O4 — CID 69136397
2-[3-[[2-[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl]-N-piperidin-4-ylanilino]methyl]phenyl]acetic acid (PubChem CID 69136397) has the molecular formula C32H41N7O4 and a molecular weight of 587.73 g/mol. Its IUPAC name is 2-[3-[[2-[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl]-N-piperidin-4-ylanilino]methyl]phenyl]acetic acid.
| Compound Name | 2-[3-[[2-[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl]-N-piperidin-4-ylanilino]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 69136397 |
| Molecular Formula | C32H41N7O4 |
| Molecular Weight | 587.73 g/mol |
| Exact Mass | 587.32 |
| IUPAC Name | 2-[3-[[2-[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl]-N-piperidin-4-ylanilino]methyl]phenyl]acetic acid |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCc3ccccc3N(Cc3cccc(CC(=O)O)c3)C3CCNCC3)c2n1 |
| InChI | InChI=1S/C32H41N7O4/c1-2-3-18-43-31-36-29(33)28-30(37-31)38(32(42)35-28)17-7-11-24-10-4-5-12-26(24)39(25-13-15-34-16-14-25)21-23-9-6-8-22(19-23)20-27(40)41/h4-6,8-10,12,19,25,34H,2-3,7,11,13-18,20-21H2,1H3,(H,35,42)(H,40,41)(H2,33,36,37) |
| InChIKey | NBNQMUQXCPCPHV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 151.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.73 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|