C25H36N6O5 — CID 67404691
2-[3-[[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl-(2-methoxyethyl)amino]methyl]-4-ethylphenyl]acetic acid (PubChem CID 67404691) has the molecular formula C25H36N6O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is 2-[3-[[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl-(2-methoxyethyl)amino]methyl]-4-ethylphenyl]acetic acid.
| Compound Name | 2-[3-[[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl-(2-methoxyethyl)amino]methyl]-4-ethylphenyl]acetic acid |
|---|---|
| PubChem CID | 67404691 |
| Molecular Formula | C25H36N6O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 2-[3-[[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl-(2-methoxyethyl)amino]methyl]-4-ethylphenyl]acetic acid |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCN(CCOC)Cc3cc(CC(=O)O)ccc3CC)c2n1 |
| InChI | InChI=1S/C25H36N6O5/c1-4-6-12-36-24-28-22(26)21-23(29-24)31(25(34)27-21)10-9-30(11-13-35-3)16-19-14-17(15-20(32)33)7-8-18(19)5-2/h7-8,14H,4-6,9-13,15-16H2,1-3H3,(H,27,34)(H,32,33)(H2,26,28,29) |
| InChIKey | RRFKHYPPTIESIX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 148.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|