C29H48N8O2 — CID 25072723
6-amino-9-[[4-[[bis[2-(diethylamino)ethyl]amino]methyl]phenyl]methyl]-2-butoxy-7H-purin-8-one (PubChem CID 25072723) has the molecular formula C29H48N8O2 and a molecular weight of 540.76 g/mol. Its IUPAC name is 6-amino-9-[[4-[[bis[2-(diethylamino)ethyl]amino]methyl]phenyl]methyl]-2-butoxy-7H-purin-8-one.
| Compound Name | 6-amino-9-[[4-[[bis[2-(diethylamino)ethyl]amino]methyl]phenyl]methyl]-2-butoxy-7H-purin-8-one |
|---|---|
| PubChem CID | 25072723 |
| Molecular Formula | C29H48N8O2 |
| Molecular Weight | 540.76 g/mol |
| Exact Mass | 540.39 |
| IUPAC Name | 6-amino-9-[[4-[[bis[2-(diethylamino)ethyl]amino]methyl]phenyl]methyl]-2-butoxy-7H-purin-8-one |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CN(CCN(CC)CC)CCN(CC)CC)cc3)c2n1 |
| InChI | InChI=1S/C29H48N8O2/c1-6-11-20-39-28-32-26(30)25-27(33-28)37(29(38)31-25)22-24-14-12-23(13-15-24)21-36(18-16-34(7-2)8-3)19-17-35(9-4)10-5/h12-15H,6-11,16-22H2,1-5H3,(H,31,38)(H2,30,32,33) |
| InChIKey | PIGTVMIISYRZKE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 108.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.76 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|