C17H19N7O2 — CID 23158773
2-[6-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-2-pyridinyl]acetonitrile (PubChem CID 23158773) has the molecular formula C17H19N7O2 and a molecular weight of 353.39 g/mol. Its IUPAC name is 2-[6-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-2-pyridinyl]acetonitrile.
| Compound Name | 2-[6-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 23158773 |
| Molecular Formula | C17H19N7O2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 2-[6-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-2-pyridinyl]acetonitrile |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3cccc(CC#N)n3)c2n1 |
| InChI | InChI=1S/C17H19N7O2/c1-2-3-9-26-16-22-14(19)13-15(23-16)24(17(25)21-13)10-12-6-4-5-11(20-12)7-8-18/h4-6H,2-3,7,9-10H2,1H3,(H,21,25)(H2,19,22,23) |
| InChIKey | IAUXOLMQCZACGM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 135.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|