C25H28N8O3 — CID 154702413
3-[[6-[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenoxy]-2-pyridinyl]methylamino]propanenitrile (PubChem CID 154702413) has the molecular formula C25H28N8O3 and a molecular weight of 488.55 g/mol. Its IUPAC name is 3-[[6-[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenoxy]-2-pyridinyl]methylamino]propanenitrile.
| Compound Name | 3-[[6-[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenoxy]-2-pyridinyl]methylamino]propanenitrile |
|---|---|
| PubChem CID | 154702413 |
| Molecular Formula | C25H28N8O3 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 3-[[6-[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenoxy]-2-pyridinyl]methylamino]propanenitrile |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(Oc4cccc(CNCCC#N)n4)cc3)c2n1 |
| InChI | InChI=1S/C25H28N8O3/c1-2-3-14-35-24-31-22(27)21-23(32-24)33(25(34)30-21)16-17-8-10-19(11-9-17)36-20-7-4-6-18(29-20)15-28-13-5-12-26/h4,6-11,28H,2-3,5,13-16H2,1H3,(H,30,34)(H2,27,31,32) |
| InChIKey | VURKPPYSMXUJLF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 156.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|