C28H43N7O4 — CID 162737125
tert-butyl N-[6-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methylamino]hexyl]carbamate (PubChem CID 162737125) has the molecular formula C28H43N7O4 and a molecular weight of 541.70 g/mol. Its IUPAC name is tert-butyl N-[6-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methylamino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 162737125 |
| Molecular Formula | C28H43N7O4 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.34 |
| IUPAC Name | tert-butyl N-[6-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methylamino]hexyl]carbamate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CNCCCCCCNC(=O)OC(C)(C)C)cc3)c2n1 |
| InChI | InChI=1S/C28H43N7O4/c1-5-6-17-38-25-33-23(29)22-24(34-25)35(26(36)32-22)19-21-13-11-20(12-14-21)18-30-15-9-7-8-10-16-31-27(37)39-28(2,3)4/h11-14,30H,5-10,15-19H2,1-4H3,(H,31,37)(H,32,36)(H2,29,33,34) |
| InChIKey | XRZQEBOXHUWQOQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|