C24H34N8O4 — CID 158389294
1-[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]-3-(5-amino-6-oxoheptyl)urea (PubChem CID 158389294) has the molecular formula C24H34N8O4 and a molecular weight of 498.59 g/mol. Its IUPAC name is 1-[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]-3-(5-amino-6-oxoheptyl)urea.
| Compound Name | 1-[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]-3-(5-amino-6-oxoheptyl)urea |
|---|---|
| PubChem CID | 158389294 |
| Molecular Formula | C24H34N8O4 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 1-[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]-3-(5-amino-6-oxoheptyl)urea |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(NC(=O)NCCCCC(N)C(C)=O)cc3)c2n1 |
| InChI | InChI=1S/C24H34N8O4/c1-3-4-13-36-23-30-20(26)19-21(31-23)32(24(35)29-19)14-16-8-10-17(11-9-16)28-22(34)27-12-6-5-7-18(25)15(2)33/h8-11,18H,3-7,12-14,25H2,1-2H3,(H,29,35)(H2,26,30,31)(H2,27,28,34) |
| InChIKey | GWTDJYXCWDMRRT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 183.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|