C31H44N10O8 — CID 172699236
4-[[(2S)-1-[[(2S)-1-[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 172699236) has the molecular formula C31H44N10O8 and a molecular weight of 684.75 g/mol. Its IUPAC name is 4-[[(2S)-1-[[(2S)-1-[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(2S)-1-[[(2S)-1-[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 172699236 |
| Molecular Formula | C31H44N10O8 |
| Molecular Weight | 684.75 g/mol |
| Exact Mass | 684.33 |
| IUPAC Name | 4-[[(2S)-1-[[(2S)-1-[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@@H](NC(=O)CCC(=O)O)C(C)C)cc3)c2n1 |
| InChI | InChI=1S/C31H44N10O8/c1-4-5-15-49-30-39-25(32)24-26(40-30)41(31(48)38-24)16-18-8-10-19(11-9-18)35-27(45)20(7-6-14-34-29(33)47)36-28(46)23(17(2)3)37-21(42)12-13-22(43)44/h8-11,17,20,23H,4-7,12-16H2,1-3H3,(H,35,45)(H,36,46)(H,37,42)(H,38,48)(H,43,44)(H2,32,39,40)(H3,33,34,47)/t20-,23-/m0/s1 |
| InChIKey | CSVKBGAMMFXCCD-REWPJTCUSA-N |
| XLogP | 0.81 |
| TPSA | 278.54 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.75 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|