C17H20N6O4 — CID 67263303
methyl 4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]pyridine-2-carboxylate (PubChem CID 67263303) has the molecular formula C17H20N6O4 and a molecular weight of 372.39 g/mol. Its IUPAC name is methyl 4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]pyridine-2-carboxylate.
| Compound Name | methyl 4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 67263303 |
| Molecular Formula | C17H20N6O4 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | methyl 4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]pyridine-2-carboxylate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccnc(C(=O)OC)c3)c2n1 |
| InChI | InChI=1S/C17H20N6O4/c1-3-4-7-27-16-21-13(18)12-14(22-16)23(17(25)20-12)9-10-5-6-19-11(8-10)15(24)26-2/h5-6,8H,3-4,7,9H2,1-2H3,(H,20,25)(H2,18,21,22) |
| InChIKey | FBQVBIZZNRCPJT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 138.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|