C19H20F3N5O4 — CID 67263354
2,2,2-trifluoroethyl 3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]benzoate (PubChem CID 67263354) has the molecular formula C19H20F3N5O4 and a molecular weight of 439.39 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]benzoate.
| Compound Name | 2,2,2-trifluoroethyl 3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]benzoate |
|---|---|
| PubChem CID | 67263354 |
| Molecular Formula | C19H20F3N5O4 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 2,2,2-trifluoroethyl 3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]benzoate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3cccc(C(=O)OCC(F)(F)F)c3)c2n1 |
| InChI | InChI=1S/C19H20F3N5O4/c1-2-3-7-30-17-25-14(23)13-15(26-17)27(18(29)24-13)9-11-5-4-6-12(8-11)16(28)31-10-19(20,21)22/h4-6,8H,2-3,7,9-10H2,1H3,(H,24,29)(H2,23,25,26) |
| InChIKey | UIQWUAILVHTDQW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|