C18H25N5O4 — CID 143605693
6-amino-9-[[3-(hydroxymethyl)phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one;ethane (PubChem CID 143605693) has the molecular formula C18H25N5O4 and a molecular weight of 375.43 g/mol. Its IUPAC name is 6-amino-9-[[3-(hydroxymethyl)phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one;ethane.
| Compound Name | 6-amino-9-[[3-(hydroxymethyl)phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one;ethane |
|---|---|
| PubChem CID | 143605693 |
| Molecular Formula | C18H25N5O4 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 6-amino-9-[[3-(hydroxymethyl)phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one;ethane |
| SMILES | CC.COCCOc1nc(N)c2[nH]c(=O)n(Cc3cccc(CO)c3)c2n1 |
| InChI | InChI=1S/C16H19N5O4.C2H6/c1-24-5-6-25-15-19-13(17)12-14(20-15)21(16(23)18-12)8-10-3-2-4-11(7-10)9-22;1-2/h2-4,7,22H,5-6,8-9H2,1H3,(H,18,23)(H2,17,19,20);1-2H3 |
| InChIKey | UNALKZWTNDCHOD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|