C22H28N5O8P — CID 90813658
[2-[3-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]-1-hydroxy-1-phosphorosooxyethyl] 2,2-dimethylpropanoate (PubChem CID 90813658) has the molecular formula C22H28N5O8P and a molecular weight of 521.47 g/mol. Its IUPAC name is [2-[3-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]-1-hydroxy-1-phosphorosooxyethyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[3-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]-1-hydroxy-1-phosphorosooxyethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 90813658 |
| Molecular Formula | C22H28N5O8P |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | [2-[3-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]-1-hydroxy-1-phosphorosooxyethyl] 2,2-dimethylpropanoate |
| SMILES | COCCOc1nc(N)c2[nH]c(=O)n(Cc3cccc(CC(O)(OP=O)OC(=O)C(C)(C)C)c3)c2n1 |
| InChI | InChI=1S/C22H28N5O8P/c1-21(2,3)18(28)34-22(30,35-36-31)11-13-6-5-7-14(10-13)12-27-17-15(24-20(27)29)16(23)25-19(26-17)33-9-8-32-4/h5-7,10,30H,8-9,11-12H2,1-4H3,(H,24,29)(H2,23,25,26) |
| InChIKey | RMOOOZBFVXBDNB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 180.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|