C20H25N5O5 — CID 11604054
2-hydroxyethyl 2-[3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]acetate (PubChem CID 11604054) has the molecular formula C20H25N5O5 and a molecular weight of 415.45 g/mol. Its IUPAC name is 2-hydroxyethyl 2-[3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]acetate.
| Compound Name | 2-hydroxyethyl 2-[3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]acetate |
|---|---|
| PubChem CID | 11604054 |
| Molecular Formula | C20H25N5O5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 2-hydroxyethyl 2-[3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]acetate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3cccc(CC(=O)OCCO)c3)c2n1 |
| InChI | InChI=1S/C20H25N5O5/c1-2-3-8-30-19-23-17(21)16-18(24-19)25(20(28)22-16)12-14-6-4-5-13(10-14)11-15(27)29-9-7-26/h4-6,10,26H,2-3,7-9,11-12H2,1H3,(H,22,28)(H2,21,23,24) |
| InChIKey | SBGGMPAXPRBBHA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|