C20H25FN6O4 — CID 23158767
2-fluoroethyl 2-[5-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]-3-pyridinyl]acetate (PubChem CID 23158767) has the molecular formula C20H25FN6O4 and a molecular weight of 432.46 g/mol. Its IUPAC name is 2-fluoroethyl 2-[5-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]-3-pyridinyl]acetate.
| Compound Name | 2-fluoroethyl 2-[5-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 23158767 |
| Molecular Formula | C20H25FN6O4 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 2-fluoroethyl 2-[5-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]-3-pyridinyl]acetate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCc3cncc(CC(=O)OCCF)c3)c2n1 |
| InChI | InChI=1S/C20H25FN6O4/c1-2-3-7-31-19-25-17(22)16-18(26-19)27(20(29)24-16)6-4-13-9-14(12-23-11-13)10-15(28)30-8-5-21/h9,11-12H,2-8,10H2,1H3,(H,24,29)(H2,22,25,26) |
| InChIKey | VUCUKRFAFMHEFV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 138.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|