About 2-fluoroethyl 2-[5-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]-3-pyridinyl]acetate
2-fluoroethyl 2-[5-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]-3-pyridinyl]acetate (PubChem CID 23158767) has the molecular formula C20H25FN6O4
and a molecular weight of 432.46 g/mol. Its IUPAC name is 2-fluoroethyl 2-[5-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]-3-pyridinyl]acetate.
Molecular Properties
| Compound Name | 2-fluoroethyl 2-[5-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]-3-pyridinyl]acetate |
| PubChem CID | 23158767 |
| Molecular Formula | C20H25FN6O4 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 2-fluoroethyl 2-[5-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]-3-pyridinyl]acetate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCc3cncc(CC(=O)OCCF)c3)c2n1 |
| InChI | InChI=1S/C20H25FN6O4/c1-2-3-7-31-19-25-17(22)16-18(26-19)27(20(29)24-16)6-4-13-9-14(12-23-11-13)10-15(28)30-8-5-21/h9,11-12H,2-8,10H2,1H3,(H,24,29)(H2,22,25,26) |
| InChIKey | VUCUKRFAFMHEFV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 138.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroethyl 2-[5-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]-3-pyridinyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethyl 2-[5-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]-3-pyridinyl]acetate?
The IUPAC name of 2-fluoroethyl 2-[5-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]-3-pyridinyl]acetate (CID 23158767) is 2-fluoroethyl 2-[5-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]-3-pyridinyl]acetate.
What is the SMILES notation for 2-fluoroethyl 2-[5-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]-3-pyridinyl]acetate?
The canonical SMILES for 2-fluoroethyl 2-[5-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]-3-pyridinyl]acetate is CCCCOc1nc(N)c2[nH]c(=O)n(CCc3cncc(CC(=O)OCCF)c3)c2n1.
What is the InChIKey of 2-fluoroethyl 2-[5-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]-3-pyridinyl]acetate?
The InChIKey is VUCUKRFAFMHEFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25FN6O4/c1-2-3-7-31-19-25-17(22)16-18(26-19)27(20(29)24-16)6-4-13-9-14(12-23-11-13)10-15(28)30-8-5-21/h9,11-12H,2-8,10H2,1H3,(H,24,29)(H2,22,25,26).
What are the key properties of 2-fluoroethyl 2-[5-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]-3-pyridinyl]acetate?
2-fluoroethyl 2-[5-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]-3-pyridinyl]acetate has a molecular weight of 432.46 g/mol, XLogP of 1.57, 11 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl 2-[5-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]-3-pyridinyl]acetate is sourced from PubChem (CID 23158767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).