C18H21N5O5 — CID 11531154
methyl 2-[3-[[6-amino-2-(3-hydroxypropoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]acetate (PubChem CID 11531154) has the molecular formula C18H21N5O5 and a molecular weight of 387.40 g/mol. Its IUPAC name is methyl 2-[3-[[6-amino-2-(3-hydroxypropoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]acetate.
| Compound Name | methyl 2-[3-[[6-amino-2-(3-hydroxypropoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 11531154 |
| Molecular Formula | C18H21N5O5 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | methyl 2-[3-[[6-amino-2-(3-hydroxypropoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(Cn2c(=O)[nH]c3c(N)nc(OCCCO)nc32)c1 |
| InChI | InChI=1S/C18H21N5O5/c1-27-13(25)9-11-4-2-5-12(8-11)10-23-16-14(20-18(23)26)15(19)21-17(22-16)28-7-3-6-24/h2,4-5,8,24H,3,6-7,9-10H2,1H3,(H,20,26)(H2,19,21,22) |
| InChIKey | DCLANUZBOPPEPV-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|