C18H24N5O4P — CID 24898959
[3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl-methylphosphinic acid (PubChem CID 24898959) has the molecular formula C18H24N5O4P and a molecular weight of 405.40 g/mol. Its IUPAC name is [3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl-methylphosphinic acid.
| Compound Name | [3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl-methylphosphinic acid |
|---|---|
| PubChem CID | 24898959 |
| Molecular Formula | C18H24N5O4P |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | [3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl-methylphosphinic acid |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3cccc(CP(C)(=O)O)c3)c2n1 |
| InChI | InChI=1S/C18H24N5O4P/c1-3-4-8-27-17-21-15(19)14-16(22-17)23(18(24)20-14)10-12-6-5-7-13(9-12)11-28(2,25)26/h5-7,9H,3-4,8,10-11H2,1-2H3,(H,20,24)(H,25,26)(H2,19,21,22) |
| InChIKey | NPWDGGLLHZRLQP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|