C25H36N6O4 — CID 23158692
3-(diethylamino)propyl 2-[3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]acetate (PubChem CID 23158692) has the molecular formula C25H36N6O4 and a molecular weight of 484.60 g/mol. Its IUPAC name is 3-(diethylamino)propyl 2-[3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]acetate.
| Compound Name | 3-(diethylamino)propyl 2-[3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]acetate |
|---|---|
| PubChem CID | 23158692 |
| Molecular Formula | C25H36N6O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 3-(diethylamino)propyl 2-[3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]acetate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3cccc(CC(=O)OCCCN(CC)CC)c3)c2n1 |
| InChI | InChI=1S/C25H36N6O4/c1-4-7-13-35-24-28-22(26)21-23(29-24)31(25(33)27-21)17-19-11-8-10-18(15-19)16-20(32)34-14-9-12-30(5-2)6-3/h8,10-11,15H,4-7,9,12-14,16-17H2,1-3H3,(H,27,33)(H2,26,28,29) |
| InChIKey | SRBXZBXXBAWPNF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|