C25H36N6O5 — CID 11620313
4-(dimethylamino)butyl 2-[3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-4-methoxyphenyl]acetate (PubChem CID 11620313) has the molecular formula C25H36N6O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is 4-(dimethylamino)butyl 2-[3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-4-methoxyphenyl]acetate.
| Compound Name | 4-(dimethylamino)butyl 2-[3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-4-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 11620313 |
| Molecular Formula | C25H36N6O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 4-(dimethylamino)butyl 2-[3-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-4-methoxyphenyl]acetate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3cc(CC(=O)OCCCCN(C)C)ccc3OC)c2n1 |
| InChI | InChI=1S/C25H36N6O5/c1-5-6-12-36-24-28-22(26)21-23(29-24)31(25(33)27-21)16-18-14-17(9-10-19(18)34-4)15-20(32)35-13-8-7-11-30(2)3/h9-10,14H,5-8,11-13,15-16H2,1-4H3,(H,27,33)(H2,26,28,29) |
| InChIKey | SFJIOXNJFIGDHU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 137.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|