C23H32N6O4 — CID 11612236
methyl 2-[3-[[4-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)butylamino]methyl]phenyl]acetate (PubChem CID 11612236) has the molecular formula C23H32N6O4 and a molecular weight of 456.55 g/mol. Its IUPAC name is methyl 2-[3-[[4-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)butylamino]methyl]phenyl]acetate.
| Compound Name | methyl 2-[3-[[4-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)butylamino]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 11612236 |
| Molecular Formula | C23H32N6O4 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | methyl 2-[3-[[4-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)butylamino]methyl]phenyl]acetate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCCNCc3cccc(CC(=O)OC)c3)c2n1 |
| InChI | InChI=1S/C23H32N6O4/c1-3-4-12-33-22-27-20(24)19-21(28-22)29(23(31)26-19)11-6-5-10-25-15-17-9-7-8-16(13-17)14-18(30)32-2/h7-9,13,25H,3-6,10-12,14-15H2,1-2H3,(H,26,31)(H2,24,27,28) |
| InChIKey | CPMKWGIOOZUIBR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|