C25H36N6O8S — CID 11621196
methyl 2-[3-[4-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)butyl-[(2R)-2,3-dihydroxypropyl]sulfamoyl]phenyl]acetate (PubChem CID 11621196) has the molecular formula C25H36N6O8S and a molecular weight of 580.66 g/mol. Its IUPAC name is methyl 2-[3-[4-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)butyl-[(2R)-2,3-dihydroxypropyl]sulfamoyl]phenyl]acetate.
| Compound Name | methyl 2-[3-[4-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)butyl-[(2R)-2,3-dihydroxypropyl]sulfamoyl]phenyl]acetate |
|---|---|
| PubChem CID | 11621196 |
| Molecular Formula | C25H36N6O8S |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | methyl 2-[3-[4-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)butyl-[(2R)-2,3-dihydroxypropyl]sulfamoyl]phenyl]acetate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCCN(C[C@@H](O)CO)S(=O)(=O)c3cccc(CC(=O)OC)c3)c2n1 |
| InChI | InChI=1S/C25H36N6O8S/c1-3-4-12-39-24-28-22(26)21-23(29-24)31(25(35)27-21)11-6-5-10-30(15-18(33)16-32)40(36,37)19-9-7-8-17(13-19)14-20(34)38-2/h7-9,13,18,32-33H,3-6,10-12,14-16H2,1-2H3,(H,27,35)(H2,26,28,29)/t18-/m1/s1 |
| InChIKey | SJBHSNYYJDEUFX-GOSISDBHSA-N |
| XLogP | 0.42 |
| TPSA | 202.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|