C19H23N5O6S — CID 69475226
[3-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethylsulfonyl]phenyl] acetate (PubChem CID 69475226) has the molecular formula C19H23N5O6S and a molecular weight of 449.49 g/mol. Its IUPAC name is [3-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethylsulfonyl]phenyl] acetate.
| Compound Name | [3-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethylsulfonyl]phenyl] acetate |
|---|---|
| PubChem CID | 69475226 |
| Molecular Formula | C19H23N5O6S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | [3-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethylsulfonyl]phenyl] acetate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCS(=O)(=O)c3cccc(OC(C)=O)c3)c2n1 |
| InChI | InChI=1S/C19H23N5O6S/c1-3-4-9-29-18-22-16(20)15-17(23-18)24(19(26)21-15)8-10-31(27,28)14-7-5-6-13(11-14)30-12(2)25/h5-7,11H,3-4,8-10H2,1-2H3,(H,21,26)(H2,20,22,23) |
| InChIKey | XVSUZJXABHFIME-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 159.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|