C25H37N7O4 — CID 69121149
[3-[[[5-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)-1-(dimethylamino)pentan-2-yl]amino]methyl]phenyl] acetate (PubChem CID 69121149) has the molecular formula C25H37N7O4 and a molecular weight of 499.62 g/mol. Its IUPAC name is [3-[[[5-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)-1-(dimethylamino)pentan-2-yl]amino]methyl]phenyl] acetate.
| Compound Name | [3-[[[5-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)-1-(dimethylamino)pentan-2-yl]amino]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 69121149 |
| Molecular Formula | C25H37N7O4 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | [3-[[[5-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)-1-(dimethylamino)pentan-2-yl]amino]methyl]phenyl] acetate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCC(CN(C)C)NCc3cccc(OC(C)=O)c3)c2n1 |
| InChI | InChI=1S/C25H37N7O4/c1-5-6-13-35-24-29-22(26)21-23(30-24)32(25(34)28-21)12-8-10-19(16-31(3)4)27-15-18-9-7-11-20(14-18)36-17(2)33/h7,9,11,14,19,27H,5-6,8,10,12-13,15-16H2,1-4H3,(H,28,34)(H2,26,29,30) |
| InChIKey | ZWSUXUSJXIYYHI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 140.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|