C22H30N6O4 — CID 66781805
2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propylamino]methyl]phenyl]propanoic acid (PubChem CID 66781805) has the molecular formula C22H30N6O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propylamino]methyl]phenyl]propanoic acid.
| Compound Name | 2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propylamino]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 66781805 |
| Molecular Formula | C22H30N6O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propylamino]methyl]phenyl]propanoic acid |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCNCc3cccc(C(C)C(=O)O)c3)c2n1 |
| InChI | InChI=1S/C22H30N6O4/c1-3-4-11-32-21-26-18(23)17-19(27-21)28(22(31)25-17)10-6-9-24-13-15-7-5-8-16(12-15)14(2)20(29)30/h5,7-8,12,14,24H,3-4,6,9-11,13H2,1-2H3,(H,25,31)(H,29,30)(H2,23,26,27) |
| InChIKey | KOEMDAVTHDRFGI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 148.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|