C25H34N6O5S — CID 66781407
2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-(2-methylsulfanylacetyl)amino]methyl]phenyl]propanoic acid (PubChem CID 66781407) has the molecular formula C25H34N6O5S and a molecular weight of 530.65 g/mol. Its IUPAC name is 2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-(2-methylsulfanylacetyl)amino]methyl]phenyl]propanoic acid.
| Compound Name | 2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-(2-methylsulfanylacetyl)amino]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 66781407 |
| Molecular Formula | C25H34N6O5S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | 2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-(2-methylsulfanylacetyl)amino]methyl]phenyl]propanoic acid |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCN(Cc3cccc(C(C)C(=O)O)c3)C(=O)CSC)c2n1 |
| InChI | InChI=1S/C25H34N6O5S/c1-4-5-12-36-24-28-21(26)20-22(29-24)31(25(35)27-20)11-7-10-30(19(32)15-37-3)14-17-8-6-9-18(13-17)16(2)23(33)34/h6,8-9,13,16H,4-5,7,10-12,14-15H2,1-3H3,(H,27,35)(H,33,34)(H2,26,28,29) |
| InChIKey | MFJBMOGXIRRXAF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|