C24H34N6O5 — CID 67389642
2-[3-[[2-(6-amino-2-butoxy-8-methoxypurin-9-yl)ethyl-(2-hydroxyethyl)amino]methyl]phenyl]propanoic acid (PubChem CID 67389642) has the molecular formula C24H34N6O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is 2-[3-[[2-(6-amino-2-butoxy-8-methoxypurin-9-yl)ethyl-(2-hydroxyethyl)amino]methyl]phenyl]propanoic acid.
| Compound Name | 2-[3-[[2-(6-amino-2-butoxy-8-methoxypurin-9-yl)ethyl-(2-hydroxyethyl)amino]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67389642 |
| Molecular Formula | C24H34N6O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 2-[3-[[2-(6-amino-2-butoxy-8-methoxypurin-9-yl)ethyl-(2-hydroxyethyl)amino]methyl]phenyl]propanoic acid |
| SMILES | CCCCOc1nc(N)c2nc(OC)n(CCN(CCO)Cc3cccc(C(C)C(=O)O)c3)c2n1 |
| InChI | InChI=1S/C24H34N6O5/c1-4-5-13-35-23-27-20(25)19-21(28-23)30(24(26-19)34-3)10-9-29(11-12-31)15-17-7-6-8-18(14-17)16(2)22(32)33/h6-8,14,16,31H,4-5,9-13,15H2,1-3H3,(H,32,33)(H2,25,27,28) |
| InChIKey | VUVCVQLIRKBAIX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|