C18H30N6O4 — CID 66781348
3-(6-amino-2-butoxy-8-methoxypurin-9-yl)propyl-tert-butylcarbamic acid (PubChem CID 66781348) has the molecular formula C18H30N6O4 and a molecular weight of 394.48 g/mol. Its IUPAC name is 3-(6-amino-2-butoxy-8-methoxypurin-9-yl)propyl-tert-butylcarbamic acid.
| Compound Name | 3-(6-amino-2-butoxy-8-methoxypurin-9-yl)propyl-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 66781348 |
| Molecular Formula | C18H30N6O4 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 3-(6-amino-2-butoxy-8-methoxypurin-9-yl)propyl-tert-butylcarbamic acid |
| SMILES | CCCCOc1nc(N)c2nc(OC)n(CCCN(C(=O)O)C(C)(C)C)c2n1 |
| InChI | InChI=1S/C18H30N6O4/c1-6-7-11-28-15-21-13(19)12-14(22-15)23(16(20-12)27-5)9-8-10-24(17(25)26)18(2,3)4/h6-11H2,1-5H3,(H,25,26)(H2,19,21,22) |
| InChIKey | OSHVUXYLBCQBLN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|