C22H39N7O2 — CID 58291076
2-butoxy-9-[6-(4-ethylpiperazin-1-yl)hexyl]-8-methoxypurin-6-amine (PubChem CID 58291076) has the molecular formula C22H39N7O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is 2-butoxy-9-[6-(4-ethylpiperazin-1-yl)hexyl]-8-methoxypurin-6-amine.
| Compound Name | 2-butoxy-9-[6-(4-ethylpiperazin-1-yl)hexyl]-8-methoxypurin-6-amine |
|---|---|
| PubChem CID | 58291076 |
| Molecular Formula | C22H39N7O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.32 |
| IUPAC Name | 2-butoxy-9-[6-(4-ethylpiperazin-1-yl)hexyl]-8-methoxypurin-6-amine |
| SMILES | CCCCOc1nc(N)c2nc(OC)n(CCCCCCN3CCN(CC)CC3)c2n1 |
| InChI | InChI=1S/C22H39N7O2/c1-4-6-17-31-21-25-19(23)18-20(26-21)29(22(24-18)30-3)12-10-8-7-9-11-28-15-13-27(5-2)14-16-28/h4-17H2,1-3H3,(H2,23,25,26) |
| InChIKey | KQMZNYJAWUFZAF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|