C21H37N7O2 — CID 58291024
2-butoxy-9-[5-(4-ethylpiperazin-1-yl)pentyl]-8-methoxypurin-6-amine (PubChem CID 58291024) has the molecular formula C21H37N7O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-butoxy-9-[5-(4-ethylpiperazin-1-yl)pentyl]-8-methoxypurin-6-amine.
| Compound Name | 2-butoxy-9-[5-(4-ethylpiperazin-1-yl)pentyl]-8-methoxypurin-6-amine |
|---|---|
| PubChem CID | 58291024 |
| Molecular Formula | C21H37N7O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | 2-butoxy-9-[5-(4-ethylpiperazin-1-yl)pentyl]-8-methoxypurin-6-amine |
| SMILES | CCCCOc1nc(N)c2nc(OC)n(CCCCCN3CCN(CC)CC3)c2n1 |
| InChI | InChI=1S/C21H37N7O2/c1-4-6-16-30-20-24-18(22)17-19(25-20)28(21(23-17)29-3)11-9-7-8-10-27-14-12-26(5-2)13-15-27/h4-16H2,1-3H3,(H2,22,24,25) |
| InChIKey | GARMFESYCJJSGV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|