C19H33N7O2 — CID 58291008
2-butoxy-9-[3-(4-ethylpiperazin-1-yl)propyl]-8-methoxypurin-6-amine (PubChem CID 58291008) has the molecular formula C19H33N7O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 2-butoxy-9-[3-(4-ethylpiperazin-1-yl)propyl]-8-methoxypurin-6-amine.
| Compound Name | 2-butoxy-9-[3-(4-ethylpiperazin-1-yl)propyl]-8-methoxypurin-6-amine |
|---|---|
| PubChem CID | 58291008 |
| Molecular Formula | C19H33N7O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 2-butoxy-9-[3-(4-ethylpiperazin-1-yl)propyl]-8-methoxypurin-6-amine |
| SMILES | CCCCOc1nc(N)c2nc(OC)n(CCCN3CCN(CC)CC3)c2n1 |
| InChI | InChI=1S/C19H33N7O2/c1-4-6-14-28-18-22-16(20)15-17(23-18)26(19(21-15)27-3)9-7-8-25-12-10-24(5-2)11-13-25/h4-14H2,1-3H3,(H2,20,22,23) |
| InChIKey | AEWSKMGBLRPNDK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|