C14H22ClN5O2 — CID 135129626
2-butoxy-9-(3-chloropropyl)-8-methoxy-N-methylpurin-6-amine (PubChem CID 135129626) has the molecular formula C14H22ClN5O2 and a molecular weight of 327.82 g/mol. Its IUPAC name is 2-butoxy-9-(3-chloropropyl)-8-methoxy-N-methylpurin-6-amine.
| Compound Name | 2-butoxy-9-(3-chloropropyl)-8-methoxy-N-methylpurin-6-amine |
|---|---|
| PubChem CID | 135129626 |
| Molecular Formula | C14H22ClN5O2 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 2-butoxy-9-(3-chloropropyl)-8-methoxy-N-methylpurin-6-amine |
| SMILES | CCCCOc1nc(NC)c2nc(OC)n(CCCCl)c2n1 |
| InChI | InChI=1S/C14H22ClN5O2/c1-4-5-9-22-13-18-11(16-2)10-12(19-13)20(8-6-7-15)14(17-10)21-3/h4-9H2,1-3H3,(H,16,18,19) |
| InChIKey | SWWVGYDJSDIOJD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|