C16H26N6O2 — CID 58306241
2-butoxy-8-methoxy-9-(piperidin-3-ylmethyl)purin-6-amine (PubChem CID 58306241) has the molecular formula C16H26N6O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-butoxy-8-methoxy-9-(piperidin-3-ylmethyl)purin-6-amine.
| Compound Name | 2-butoxy-8-methoxy-9-(piperidin-3-ylmethyl)purin-6-amine |
|---|---|
| PubChem CID | 58306241 |
| Molecular Formula | C16H26N6O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 2-butoxy-8-methoxy-9-(piperidin-3-ylmethyl)purin-6-amine |
| SMILES | CCCCOc1nc(N)c2nc(OC)n(CC3CCCNC3)c2n1 |
| InChI | InChI=1S/C16H26N6O2/c1-3-4-8-24-15-20-13(17)12-14(21-15)22(16(19-12)23-2)10-11-6-5-7-18-9-11/h11,18H,3-10H2,1-2H3,(H2,17,20,21) |
| InChIKey | DRNOTFRUDAZCEY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|