C15H25ClN6O2 — CID 67607123
6-amino-2-butoxy-9-(piperidin-4-ylmethyl)-7H-purin-8-one;hydrochloride (PubChem CID 67607123) has the molecular formula C15H25ClN6O2 and a molecular weight of 356.86 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-(piperidin-4-ylmethyl)-7H-purin-8-one;hydrochloride.
| Compound Name | 6-amino-2-butoxy-9-(piperidin-4-ylmethyl)-7H-purin-8-one;hydrochloride |
|---|---|
| PubChem CID | 67607123 |
| Molecular Formula | C15H25ClN6O2 |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 6-amino-2-butoxy-9-(piperidin-4-ylmethyl)-7H-purin-8-one;hydrochloride |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CC3CCNCC3)c2n1.Cl |
| InChI | InChI=1S/C15H24N6O2.ClH/c1-2-3-8-23-14-19-12(16)11-13(20-14)21(15(22)18-11)9-10-4-6-17-7-5-10;/h10,17H,2-9H2,1H3,(H,18,22)(H2,16,19,20);1H |
| InChIKey | PANCBMFBNCXZAT-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|