C17H29ClN6O2 — CID 118727489
6-amino-2-butoxy-9-(3-piperidin-4-ylpropyl)-7H-purin-8-one;hydrochloride (PubChem CID 118727489) has the molecular formula C17H29ClN6O2 and a molecular weight of 384.91 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-(3-piperidin-4-ylpropyl)-7H-purin-8-one;hydrochloride.
| Compound Name | 6-amino-2-butoxy-9-(3-piperidin-4-ylpropyl)-7H-purin-8-one;hydrochloride |
|---|---|
| PubChem CID | 118727489 |
| Molecular Formula | C17H29ClN6O2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 6-amino-2-butoxy-9-(3-piperidin-4-ylpropyl)-7H-purin-8-one;hydrochloride |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCC3CCNCC3)c2n1.Cl |
| InChI | InChI=1S/C17H28N6O2.ClH/c1-2-3-11-25-16-21-14(18)13-15(22-16)23(17(24)20-13)10-4-5-12-6-8-19-9-7-12;/h12,19H,2-11H2,1H3,(H,20,24)(H2,18,21,22);1H |
| InChIKey | GFWPFLOYKOBJQS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|