C18H31ClN6O2 — CID 118727490
6-amino-2-butoxy-9-(4-piperidin-4-ylbutyl)-7H-purin-8-one;hydrochloride (PubChem CID 118727490) has the molecular formula C18H31ClN6O2 and a molecular weight of 398.94 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-(4-piperidin-4-ylbutyl)-7H-purin-8-one;hydrochloride.
| Compound Name | 6-amino-2-butoxy-9-(4-piperidin-4-ylbutyl)-7H-purin-8-one;hydrochloride |
|---|---|
| PubChem CID | 118727490 |
| Molecular Formula | C18H31ClN6O2 |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 6-amino-2-butoxy-9-(4-piperidin-4-ylbutyl)-7H-purin-8-one;hydrochloride |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCCC3CCNCC3)c2n1.Cl |
| InChI | InChI=1S/C18H30N6O2.ClH/c1-2-3-12-26-17-22-15(19)14-16(23-17)24(18(25)21-14)11-5-4-6-13-7-9-20-10-8-13;/h13,20H,2-12H2,1H3,(H,21,25)(H2,19,22,23);1H |
| InChIKey | NXCVEHKOPHSYTA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|