C19H33ClN6O2 — CID 118727491
6-amino-2-butoxy-9-(5-piperidin-4-ylpentyl)-7H-purin-8-one;hydrochloride (PubChem CID 118727491) has the molecular formula C19H33ClN6O2 and a molecular weight of 412.97 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-(5-piperidin-4-ylpentyl)-7H-purin-8-one;hydrochloride.
| Compound Name | 6-amino-2-butoxy-9-(5-piperidin-4-ylpentyl)-7H-purin-8-one;hydrochloride |
|---|---|
| PubChem CID | 118727491 |
| Molecular Formula | C19H33ClN6O2 |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 6-amino-2-butoxy-9-(5-piperidin-4-ylpentyl)-7H-purin-8-one;hydrochloride |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCCCC3CCNCC3)c2n1.Cl |
| InChI | InChI=1S/C19H32N6O2.ClH/c1-2-3-13-27-18-23-16(20)15-17(24-18)25(19(26)22-15)12-6-4-5-7-14-8-10-21-11-9-14;/h14,21H,2-13H2,1H3,(H,22,26)(H2,20,23,24);1H |
| InChIKey | JAXMUSKZAMULNG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|