C20H35ClN6O2 — CID 67233342
6-amino-2-butoxy-9-(6-piperidin-4-ylhexyl)-7H-purin-8-one;hydrochloride (PubChem CID 67233342) has the molecular formula C20H35ClN6O2 and a molecular weight of 426.99 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-(6-piperidin-4-ylhexyl)-7H-purin-8-one;hydrochloride.
| Compound Name | 6-amino-2-butoxy-9-(6-piperidin-4-ylhexyl)-7H-purin-8-one;hydrochloride |
|---|---|
| PubChem CID | 67233342 |
| Molecular Formula | C20H35ClN6O2 |
| Molecular Weight | 426.99 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 6-amino-2-butoxy-9-(6-piperidin-4-ylhexyl)-7H-purin-8-one;hydrochloride |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCCCCC3CCNCC3)c2n1.Cl |
| InChI | InChI=1S/C20H34N6O2.ClH/c1-2-3-14-28-19-24-17(21)16-18(25-19)26(20(27)23-16)13-7-5-4-6-8-15-9-11-22-12-10-15;/h15,22H,2-14H2,1H3,(H,23,27)(H2,21,24,25);1H |
| InChIKey | YEGDUUJUKPEFNL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.99 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|