C18H31N7O2 — CID 67183672
6-amino-2-butoxy-9-[3-(4-ethylpiperazin-1-yl)propyl]-7H-purin-8-one (PubChem CID 67183672) has the molecular formula C18H31N7O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-[3-(4-ethylpiperazin-1-yl)propyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-butoxy-9-[3-(4-ethylpiperazin-1-yl)propyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 67183672 |
| Molecular Formula | C18H31N7O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 6-amino-2-butoxy-9-[3-(4-ethylpiperazin-1-yl)propyl]-7H-purin-8-one |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCN3CCN(CC)CC3)c2n1 |
| InChI | InChI=1S/C18H31N7O2/c1-3-5-13-27-17-21-15(19)14-16(22-17)25(18(26)20-14)8-6-7-24-11-9-23(4-2)10-12-24/h3-13H2,1-2H3,(H,20,26)(H2,19,21,22) |
| InChIKey | MNFDYUQDPAWMCR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|