C22H30N6O4 — CID 67389795
2-[3-[3-(6-amino-2-butoxy-8-methoxypurin-9-yl)propylamino]phenyl]propanoic acid (PubChem CID 67389795) has the molecular formula C22H30N6O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-[3-[3-(6-amino-2-butoxy-8-methoxypurin-9-yl)propylamino]phenyl]propanoic acid.
| Compound Name | 2-[3-[3-(6-amino-2-butoxy-8-methoxypurin-9-yl)propylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67389795 |
| Molecular Formula | C22H30N6O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 2-[3-[3-(6-amino-2-butoxy-8-methoxypurin-9-yl)propylamino]phenyl]propanoic acid |
| SMILES | CCCCOc1nc(N)c2nc(OC)n(CCCNc3cccc(C(C)C(=O)O)c3)c2n1 |
| InChI | InChI=1S/C22H30N6O4/c1-4-5-12-32-21-26-18(23)17-19(27-21)28(22(25-17)31-3)11-7-10-24-16-9-6-8-15(13-16)14(2)20(29)30/h6,8-9,13-14,24H,4-5,7,10-12H2,1-3H3,(H,29,30)(H2,23,26,27) |
| InChIKey | USGLHEXUGKXIAC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|