C25H34N6O4 — CID 58306071
benzyl 4-[2-(6-amino-2-butoxy-8-methoxypurin-9-yl)ethyl]piperidine-1-carboxylate (PubChem CID 58306071) has the molecular formula C25H34N6O4 and a molecular weight of 482.59 g/mol. Its IUPAC name is benzyl 4-[2-(6-amino-2-butoxy-8-methoxypurin-9-yl)ethyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[2-(6-amino-2-butoxy-8-methoxypurin-9-yl)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58306071 |
| Molecular Formula | C25H34N6O4 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | benzyl 4-[2-(6-amino-2-butoxy-8-methoxypurin-9-yl)ethyl]piperidine-1-carboxylate |
| SMILES | CCCCOc1nc(N)c2nc(OC)n(CCC3CCN(C(=O)OCc4ccccc4)CC3)c2n1 |
| InChI | InChI=1S/C25H34N6O4/c1-3-4-16-34-23-28-21(26)20-22(29-23)31(24(27-20)33-2)15-12-18-10-13-30(14-11-18)25(32)35-17-19-8-6-5-7-9-19/h5-9,18H,3-4,10-17H2,1-2H3,(H2,26,28,29) |
| InChIKey | NZUKGVRVHZAPLO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|