C28H41N7O4 — CID 59830178
butyl 2-[3-[4-[2-(6-amino-2-butoxy-8-methoxypurin-9-yl)ethyl]piperazin-1-yl]phenyl]acetate (PubChem CID 59830178) has the molecular formula C28H41N7O4 and a molecular weight of 539.68 g/mol. Its IUPAC name is butyl 2-[3-[4-[2-(6-amino-2-butoxy-8-methoxypurin-9-yl)ethyl]piperazin-1-yl]phenyl]acetate.
| Compound Name | butyl 2-[3-[4-[2-(6-amino-2-butoxy-8-methoxypurin-9-yl)ethyl]piperazin-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 59830178 |
| Molecular Formula | C28H41N7O4 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.32 |
| IUPAC Name | butyl 2-[3-[4-[2-(6-amino-2-butoxy-8-methoxypurin-9-yl)ethyl]piperazin-1-yl]phenyl]acetate |
| SMILES | CCCCOC(=O)Cc1cccc(N2CCN(CCn3c(OC)nc4c(N)nc(OCCCC)nc43)CC2)c1 |
| InChI | InChI=1S/C28H41N7O4/c1-4-6-17-38-23(36)20-21-9-8-10-22(19-21)34-14-11-33(12-15-34)13-16-35-26-24(30-28(35)37-3)25(29)31-27(32-26)39-18-7-5-2/h8-10,19H,4-7,11-18,20H2,1-3H3,(H2,29,31,32) |
| InChIKey | OFEQLSFYECCEIZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|