C27H41N7O4 — CID 143428635
2-[3-[4-[5-[[6-amino-2-butoxy-5-(methylamino)pyrimidin-4-yl]-formylamino]pentyl]piperazin-1-yl]phenyl]acetic acid (PubChem CID 143428635) has the molecular formula C27H41N7O4 and a molecular weight of 527.67 g/mol. Its IUPAC name is 2-[3-[4-[5-[[6-amino-2-butoxy-5-(methylamino)pyrimidin-4-yl]-formylamino]pentyl]piperazin-1-yl]phenyl]acetic acid.
| Compound Name | 2-[3-[4-[5-[[6-amino-2-butoxy-5-(methylamino)pyrimidin-4-yl]-formylamino]pentyl]piperazin-1-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 143428635 |
| Molecular Formula | C27H41N7O4 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.32 |
| IUPAC Name | 2-[3-[4-[5-[[6-amino-2-butoxy-5-(methylamino)pyrimidin-4-yl]-formylamino]pentyl]piperazin-1-yl]phenyl]acetic acid |
| SMILES | CCCCOc1nc(N)c(NC)c(N(C=O)CCCCCN2CCN(c3cccc(CC(=O)O)c3)CC2)n1 |
| InChI | InChI=1S/C27H41N7O4/c1-3-4-17-38-27-30-25(28)24(29-2)26(31-27)34(20-35)12-7-5-6-11-32-13-15-33(16-14-32)22-10-8-9-21(18-22)19-23(36)37/h8-10,18,20,29H,3-7,11-17,19H2,1-2H3,(H,36,37)(H2,28,30,31) |
| InChIKey | ATRBUSOXLGYEFD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|