C22H34N6O3 — CID 145477248
N-[6-amino-2-butoxy-5-(methylamino)pyrimidin-4-yl]-N-[3-[4-[(dimethylamino)methyl]phenoxy]propyl]formamide (PubChem CID 145477248) has the molecular formula C22H34N6O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-[6-amino-2-butoxy-5-(methylamino)pyrimidin-4-yl]-N-[3-[4-[(dimethylamino)methyl]phenoxy]propyl]formamide.
| Compound Name | N-[6-amino-2-butoxy-5-(methylamino)pyrimidin-4-yl]-N-[3-[4-[(dimethylamino)methyl]phenoxy]propyl]formamide |
|---|---|
| PubChem CID | 145477248 |
| Molecular Formula | C22H34N6O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | N-[6-amino-2-butoxy-5-(methylamino)pyrimidin-4-yl]-N-[3-[4-[(dimethylamino)methyl]phenoxy]propyl]formamide |
| SMILES | CCCCOc1nc(N)c(NC)c(N(C=O)CCCOc2ccc(CN(C)C)cc2)n1 |
| InChI | InChI=1S/C22H34N6O3/c1-5-6-13-31-22-25-20(23)19(24-2)21(26-22)28(16-29)12-7-14-30-18-10-8-17(9-11-18)15-27(3)4/h8-11,16,24H,5-7,12-15H2,1-4H3,(H2,23,25,26) |
| InChIKey | GDGJSPHGZZSAHZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|