C30H40N6O3 — CID 91502142
N-[6-amino-2-butoxy-5-(methylamino)pyrimidin-4-yl]-N-[[4-[6-methyl-3-(pyrrolidin-1-ylmethyl)cyclohexa-1,3-dien-1-yl]phenyl]methyl]-2-oxoacetamide (PubChem CID 91502142) has the molecular formula C30H40N6O3 and a molecular weight of 532.69 g/mol. Its IUPAC name is N-[6-amino-2-butoxy-5-(methylamino)pyrimidin-4-yl]-N-[[4-[6-methyl-3-(pyrrolidin-1-ylmethyl)cyclohexa-1,3-dien-1-yl]phenyl]methyl]-2-oxoacetamide.
| Compound Name | N-[6-amino-2-butoxy-5-(methylamino)pyrimidin-4-yl]-N-[[4-[6-methyl-3-(pyrrolidin-1-ylmethyl)cyclohexa-1,3-dien-1-yl]phenyl]methyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 91502142 |
| Molecular Formula | C30H40N6O3 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | N-[6-amino-2-butoxy-5-(methylamino)pyrimidin-4-yl]-N-[[4-[6-methyl-3-(pyrrolidin-1-ylmethyl)cyclohexa-1,3-dien-1-yl]phenyl]methyl]-2-oxoacetamide |
| SMILES | CCCCOc1nc(N)c(NC)c(N(Cc2ccc(C3=CC(CN4CCCC4)=CCC3C)cc2)C(=O)C=O)n1 |
| InChI | InChI=1S/C30H40N6O3/c1-4-5-16-39-30-33-28(31)27(32-3)29(34-30)36(26(38)20-37)19-22-10-12-24(13-11-22)25-17-23(9-8-21(25)2)18-35-14-6-7-15-35/h9-13,17,20-21,32H,4-8,14-16,18-19H2,1-3H3,(H2,31,33,34) |
| InChIKey | AJRSSRSSGLJVKF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|