C37H45N5O4 — CID 149353681
4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxy-6-[[4-(pyrrolidin-1-ylmethyl)phenyl]methylamino]pyrimidine-5-carbaldehyde (PubChem CID 149353681) has the molecular formula C37H45N5O4 and a molecular weight of 623.80 g/mol. Its IUPAC name is 4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxy-6-[[4-(pyrrolidin-1-ylmethyl)phenyl]methylamino]pyrimidine-5-carbaldehyde.
| Compound Name | 4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxy-6-[[4-(pyrrolidin-1-ylmethyl)phenyl]methylamino]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 149353681 |
| Molecular Formula | C37H45N5O4 |
| Molecular Weight | 623.80 g/mol |
| Exact Mass | 623.35 |
| IUPAC Name | 4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxy-6-[[4-(pyrrolidin-1-ylmethyl)phenyl]methylamino]pyrimidine-5-carbaldehyde |
| SMILES | CCCCOc1nc(NCc2ccc(CN3CCCC3)cc2)c(C=O)c(N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C37H45N5O4/c1-4-5-22-46-37-39-35(38-23-28-8-10-29(11-9-28)24-41-20-6-7-21-41)34(27-43)36(40-37)42(25-30-12-16-32(44-2)17-13-30)26-31-14-18-33(45-3)19-15-31/h8-19,27H,4-7,20-26H2,1-3H3,(H,38,39,40) |
| InChIKey | YGNFPWNTBPXCKZ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.80 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|