C31H40N6O2 — CID 139540664
6-butoxy-N-[(4-methoxyphenyl)methyl]-1-[[4-(2-piperidin-1-ylethyl)phenyl]methyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 139540664) has the molecular formula C31H40N6O2 and a molecular weight of 528.70 g/mol. Its IUPAC name is 6-butoxy-N-[(4-methoxyphenyl)methyl]-1-[[4-(2-piperidin-1-ylethyl)phenyl]methyl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-butoxy-N-[(4-methoxyphenyl)methyl]-1-[[4-(2-piperidin-1-ylethyl)phenyl]methyl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 139540664 |
| Molecular Formula | C31H40N6O2 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | 6-butoxy-N-[(4-methoxyphenyl)methyl]-1-[[4-(2-piperidin-1-ylethyl)phenyl]methyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCCCOc1nc(NCc2ccc(OC)cc2)c2cnn(Cc3ccc(CCN4CCCCC4)cc3)c2n1 |
| InChI | InChI=1S/C31H40N6O2/c1-3-4-20-39-31-34-29(32-21-25-12-14-27(38-2)15-13-25)28-22-33-37(30(28)35-31)23-26-10-8-24(9-11-26)16-19-36-17-6-5-7-18-36/h8-15,22H,3-7,16-21,23H2,1-2H3,(H,32,34,35) |
| InChIKey | CYWWKPYOPVRTRV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|