C23H31N7O2 — CID 147544626
2-amino-N-[6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[3,4-d]pyrimidin-4-yl]acetamide (PubChem CID 147544626) has the molecular formula C23H31N7O2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 2-amino-N-[6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[3,4-d]pyrimidin-4-yl]acetamide.
| Compound Name | 2-amino-N-[6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[3,4-d]pyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 147544626 |
| Molecular Formula | C23H31N7O2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 2-amino-N-[6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[3,4-d]pyrimidin-4-yl]acetamide |
| SMILES | CCCCOc1nc(NC(=O)CN)c2cnn(Cc3ccc(CN4CCCC4)cc3)c2n1 |
| InChI | InChI=1S/C23H31N7O2/c1-2-3-12-32-23-27-21(26-20(31)13-24)19-14-25-30(22(19)28-23)16-18-8-6-17(7-9-18)15-29-10-4-5-11-29/h6-9,14H,2-5,10-13,15-16,24H2,1H3,(H,26,27,28,31) |
| InChIKey | FPOWWMYPHQUZLI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|