C23H30N4O — CID 174979065
2-butoxy-6-methyl-7-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrrolo[2,3-d]pyrimidine (PubChem CID 174979065) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-butoxy-6-methyl-7-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrrolo[2,3-d]pyrimidine.
| Compound Name | 2-butoxy-6-methyl-7-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 174979065 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 2-butoxy-6-methyl-7-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrrolo[2,3-d]pyrimidine |
| SMILES | CCCCOc1ncc2cc(C)n(Cc3ccc(CN4CCCC4)cc3)c2n1 |
| InChI | InChI=1S/C23H30N4O/c1-3-4-13-28-23-24-15-21-14-18(2)27(22(21)25-23)17-20-9-7-19(8-10-20)16-26-11-5-6-12-26/h7-10,14-15H,3-6,11-13,16-17H2,1-2H3 |
| InChIKey | CQQJQTYBKVZXKC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|