C32H48N6O3 — CID 147420907
decyl N-[6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[3,4-d]pyrimidin-4-yl]carbamate (PubChem CID 147420907) has the molecular formula C32H48N6O3 and a molecular weight of 564.78 g/mol. Its IUPAC name is decyl N-[6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[3,4-d]pyrimidin-4-yl]carbamate.
| Compound Name | decyl N-[6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[3,4-d]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 147420907 |
| Molecular Formula | C32H48N6O3 |
| Molecular Weight | 564.78 g/mol |
| Exact Mass | 564.38 |
| IUPAC Name | decyl N-[6-butoxy-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]pyrazolo[3,4-d]pyrimidin-4-yl]carbamate |
| SMILES | CCCCCCCCCCOC(=O)Nc1nc(OCCCC)nc2c1cnn2Cc1ccc(CN2CCCC2)cc1 |
| InChI | InChI=1S/C32H48N6O3/c1-3-5-7-8-9-10-11-14-22-41-32(39)35-29-28-23-33-38(30(28)36-31(34-29)40-21-6-4-2)25-27-17-15-26(16-18-27)24-37-19-12-13-20-37/h15-18,23H,3-14,19-22,24-25H2,1-2H3,(H,34,35,36,39) |
| InChIKey | DSLQCGKIJJNYFH-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.78 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|